ChemNet > CAS > 306936-82-3 4-[4-(Benzyloxy)phenyl]-5-methyl-4H-1,2,4-triazol-3-thiol
306936-82-3 4-[4-(Benzyloxy)phenyl]-5-methyl-4H-1,2,4-triazol-3-thiol
| Produkt-Name |
4-[4-(Benzyloxy)phenyl]-5-methyl-4H-1,2,4-triazol-3-thiol |
| Synonyme |
4-[4-(Benzyloxy)phenyl]-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-thion |
| Englischer Name |
4-[4-(benzyloxy)phenyl]-5-methyl-4H-1,2,4-triazole-3-thiol;4-[4-(benzyloxy)phenyl]-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione |
| Molekulare Formel |
C16H15N3OS |
| Molecular Weight |
297.3748 |
| InChI |
InChI=1/C16H15N3OS/c1-12-17-18-16(21)19(12)14-7-9-15(10-8-14)20-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,18,21) |
| CAS Registry Number |
306936-82-3 |
| Molecular Structure |
|
| Dichte |
1.24g/cm3 |
| Schmelzpunkt |
255℃ |
| Siedepunkt |
439°C at 760 mmHg |
| Brechungsindex |
1.649 |
| Flammpunkt |
219.3°C |
| Dampfdruck |
6.59E-08mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|